C16H22ClNO4 — CID 166169841
(2S)-2-[3-(3-chlorophenyl)propoxycarbonylamino]-4-methylpentanoic acid (PubChem CID 166169841) has the molecular formula C16H22ClNO4 and a molecular weight of 327.81 g/mol. Its IUPAC name is (2S)-2-[3-(3-chlorophenyl)propoxycarbonylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[3-(3-chlorophenyl)propoxycarbonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 166169841 |
| Molecular Formula | C16H22ClNO4 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (2S)-2-[3-(3-chlorophenyl)propoxycarbonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)OCCCc1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C16H22ClNO4/c1-11(2)9-14(15(19)20)18-16(21)22-8-4-6-12-5-3-7-13(17)10-12/h3,5,7,10-11,14H,4,6,8-9H2,1-2H3,(H,18,21)(H,19,20)/t14-/m0/s1 |
| InChIKey | DKQHBYQJMTXUBR-AWEZNQCLSA-N |
| XLogP | 3.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|