C22H25Cl2NO4 — CID 175380106
methyl 2-[1,2-bis(3-chlorophenyl)ethoxycarbonylamino]-4-methylpentanoate (PubChem CID 175380106) has the molecular formula C22H25Cl2NO4 and a molecular weight of 438.35 g/mol. Its IUPAC name is methyl 2-[1,2-bis(3-chlorophenyl)ethoxycarbonylamino]-4-methylpentanoate.
| Compound Name | methyl 2-[1,2-bis(3-chlorophenyl)ethoxycarbonylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 175380106 |
| Molecular Formula | C22H25Cl2NO4 |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | methyl 2-[1,2-bis(3-chlorophenyl)ethoxycarbonylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)OC(Cc1cccc(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H25Cl2NO4/c1-14(2)10-19(21(26)28-3)25-22(27)29-20(16-7-5-9-18(24)13-16)12-15-6-4-8-17(23)11-15/h4-9,11,13-14,19-20H,10,12H2,1-3H3,(H,25,27) |
| InChIKey | NFTSZENEFMGKTM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |