C18H24ClNO6 — CID 46608421
methyl 2-[[2-[2-(3-chlorophenoxy)propanoyloxy]acetyl]amino]-4-methylpentanoate (PubChem CID 46608421) has the molecular formula C18H24ClNO6 and a molecular weight of 385.84 g/mol. Its IUPAC name is methyl 2-[[2-[2-(3-chlorophenoxy)propanoyloxy]acetyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[2-[2-(3-chlorophenoxy)propanoyloxy]acetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 46608421 |
| Molecular Formula | C18H24ClNO6 |
| Molecular Weight | 385.84 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | methyl 2-[[2-[2-(3-chlorophenoxy)propanoyloxy]acetyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)COC(=O)C(C)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H24ClNO6/c1-11(2)8-15(18(23)24-4)20-16(21)10-25-17(22)12(3)26-14-7-5-6-13(19)9-14/h5-7,9,11-12,15H,8,10H2,1-4H3,(H,20,21) |
| InChIKey | ORPDYIDMORKAGG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.84 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |