C12H18FNO — CID 111421975
1-[(2-fluorophenyl)methylamino]-3-methylbutan-2-ol (PubChem CID 111421975) has the molecular formula C12H18FNO and a molecular weight of 211.28 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methylamino]-3-methylbutan-2-ol.
| Compound Name | 1-[(2-fluorophenyl)methylamino]-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 111421975 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 1-[(2-fluorophenyl)methylamino]-3-methylbutan-2-ol |
| SMILES | CC(C)C(O)CNCc1ccccc1F |
| InChI | InChI=1S/C12H18FNO/c1-9(2)12(15)8-14-7-10-5-3-4-6-11(10)13/h3-6,9,12,14-15H,7-8H2,1-2H3 |
| InChIKey | PVAOZSNEWBCXHE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |