C13H18FNO — CID 122660658
1-[(2-fluorophenyl)methylamino]hex-5-en-2-ol (PubChem CID 122660658) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methylamino]hex-5-en-2-ol.
| Compound Name | 1-[(2-fluorophenyl)methylamino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 122660658 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-[(2-fluorophenyl)methylamino]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CNCc1ccccc1F |
| InChI | InChI=1S/C13H18FNO/c1-2-3-7-12(16)10-15-9-11-6-4-5-8-13(11)14/h2,4-6,8,12,15-16H,1,3,7,9-10H2 |
| InChIKey | YDUNJDFGLLZLID-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|