C14H16F5NO — CID 110020518
1-[[1-(2,6-difluorophenyl)-2,2,2-trifluoroethyl]amino]hex-5-en-2-ol (PubChem CID 110020518) has the molecular formula C14H16F5NO and a molecular weight of 309.28 g/mol. Its IUPAC name is 1-[[1-(2,6-difluorophenyl)-2,2,2-trifluoroethyl]amino]hex-5-en-2-ol.
| Compound Name | 1-[[1-(2,6-difluorophenyl)-2,2,2-trifluoroethyl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 110020518 |
| Molecular Formula | C14H16F5NO |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 1-[[1-(2,6-difluorophenyl)-2,2,2-trifluoroethyl]amino]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CNC(c1c(F)cccc1F)C(F)(F)F |
| InChI | InChI=1S/C14H16F5NO/c1-2-3-5-9(21)8-20-13(14(17,18)19)12-10(15)6-4-7-11(12)16/h2,4,6-7,9,13,20-21H,1,3,5,8H2 |
| InChIKey | PPJZQSFEPZLMGO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|