C12H14ClF4N — CID 171227345
(1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]pent-4-en-1-amine;hydrochloride (PubChem CID 171227345) has the molecular formula C12H14ClF4N and a molecular weight of 283.70 g/mol. Its IUPAC name is (1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]pent-4-en-1-amine;hydrochloride.
| Compound Name | (1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]pent-4-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171227345 |
| Molecular Formula | C12H14ClF4N |
| Molecular Weight | 283.70 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]pent-4-en-1-amine;hydrochloride |
| SMILES | C=CCC[C@H](N)c1c(F)cccc1C(F)(F)F.Cl |
| InChI | InChI=1S/C12H13F4N.ClH/c1-2-3-7-10(17)11-8(12(14,15)16)5-4-6-9(11)13;/h2,4-6,10H,1,3,7,17H2;1H/t10-;/m0./s1 |
| InChIKey | WASHJZJLDCRSPX-PPHPATTJSA-N |
| XLogP | 4.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.70 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|