C10H11F4NO — CID 171227356
(3S)-3-amino-3-[2-fluoro-6-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 171227356) has the molecular formula C10H11F4NO and a molecular weight of 237.20 g/mol. Its IUPAC name is (3S)-3-amino-3-[2-fluoro-6-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | (3S)-3-amino-3-[2-fluoro-6-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 171227356 |
| Molecular Formula | C10H11F4NO |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (3S)-3-amino-3-[2-fluoro-6-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | N[C@@H](CCO)c1c(F)cccc1C(F)(F)F |
| InChI | InChI=1S/C10H11F4NO/c11-7-3-1-2-6(10(12,13)14)9(7)8(15)4-5-16/h1-3,8,16H,4-5,15H2/t8-/m0/s1 |
| InChIKey | AORJHECBDUIXKH-QMMMGPOBSA-N |
| XLogP | 2.23 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |