C10H9F6NO — CID 66515831
(2S)-2-amino-2-[2,6-bis(trifluoromethyl)phenyl]ethanol (PubChem CID 66515831) has the molecular formula C10H9F6NO and a molecular weight of 273.18 g/mol. Its IUPAC name is (2S)-2-amino-2-[2,6-bis(trifluoromethyl)phenyl]ethanol.
| Compound Name | (2S)-2-amino-2-[2,6-bis(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 66515831 |
| Molecular Formula | C10H9F6NO |
| Molecular Weight | 273.18 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (2S)-2-amino-2-[2,6-bis(trifluoromethyl)phenyl]ethanol |
| SMILES | N[C@H](CO)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C10H9F6NO/c11-9(12,13)5-2-1-3-6(10(14,15)16)8(5)7(17)4-18/h1-3,7,18H,4,17H2/t7-/m1/s1 |
| InChIKey | BSESWRGFUNQIBF-SSDOTTSWSA-N |
| XLogP | 2.72 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.18 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |