C8H11NO3 — CID 66513524
2-[(1R)-1-amino-2-hydroxyethyl]benzene-1,3-diol (PubChem CID 66513524) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2-hydroxyethyl]benzene-1,3-diol.
| Compound Name | 2-[(1R)-1-amino-2-hydroxyethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 66513524 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-[(1R)-1-amino-2-hydroxyethyl]benzene-1,3-diol |
| SMILES | N[C@@H](CO)c1c(O)cccc1O |
| InChI | InChI=1S/C8H11NO3/c9-5(4-10)8-6(11)2-1-3-7(8)12/h1-3,5,10-12H,4,9H2/t5-/m0/s1 |
| InChIKey | KYJTUYXAMPWUDJ-YFKPBYRVSA-N |
| XLogP | 0.09 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|