C11H15NO2 — CID 130061799
2-(1-amino-2-cyclopropylethyl)benzene-1,3-diol (PubChem CID 130061799) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(1-amino-2-cyclopropylethyl)benzene-1,3-diol.
| Compound Name | 2-(1-amino-2-cyclopropylethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 130061799 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-(1-amino-2-cyclopropylethyl)benzene-1,3-diol |
| SMILES | NC(CC1CC1)c1c(O)cccc1O |
| InChI | InChI=1S/C11H15NO2/c12-8(6-7-4-5-7)11-9(13)2-1-3-10(11)14/h1-3,7-8,13-14H,4-6,12H2 |
| InChIKey | NEQDUMUXNCVJFP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|