C11H16ClNO3 — CID 171217038
2-[(1R)-1-amino-2-cyclopropylethyl]benzene-1,3,5-triol;hydrochloride (PubChem CID 171217038) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2-cyclopropylethyl]benzene-1,3,5-triol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-2-cyclopropylethyl]benzene-1,3,5-triol;hydrochloride |
|---|---|
| PubChem CID | 171217038 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-[(1R)-1-amino-2-cyclopropylethyl]benzene-1,3,5-triol;hydrochloride |
| SMILES | Cl.N[C@H](CC1CC1)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C11H15NO3.ClH/c12-8(3-6-1-2-6)11-9(14)4-7(13)5-10(11)15;/h4-6,8,13-15H,1-3,12H2;1H/t8-;/m1./s1 |
| InChIKey | IFZVUTREAVNERV-DDWIOCJRSA-N |
| XLogP | 2.03 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|