C9H10F3N — CID 60922653
2,2-difluoro-N-[(2-fluorophenyl)methyl]ethanamine (PubChem CID 60922653) has the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. Its IUPAC name is 2,2-difluoro-N-[(2-fluorophenyl)methyl]ethanamine.
| Compound Name | 2,2-difluoro-N-[(2-fluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 60922653 |
| Molecular Formula | C9H10F3N |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2,2-difluoro-N-[(2-fluorophenyl)methyl]ethanamine |
| SMILES | Fc1ccccc1CNCC(F)F |
| InChI | InChI=1S/C9H10F3N/c10-8-4-2-1-3-7(8)5-13-6-9(11)12/h1-4,9,13H,5-6H2 |
| InChIKey | BIXLOKJDGJVMJC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |