C12H15F2NO2 — CID 115462288
methyl 2-[2-[(2,2-difluoroethylamino)methyl]phenyl]acetate (PubChem CID 115462288) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is methyl 2-[2-[(2,2-difluoroethylamino)methyl]phenyl]acetate.
| Compound Name | methyl 2-[2-[(2,2-difluoroethylamino)methyl]phenyl]acetate |
|---|---|
| PubChem CID | 115462288 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | methyl 2-[2-[(2,2-difluoroethylamino)methyl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccccc1CNCC(F)F |
| InChI | InChI=1S/C12H15F2NO2/c1-17-12(16)6-9-4-2-3-5-10(9)7-15-8-11(13)14/h2-5,11,15H,6-8H2,1H3 |
| InChIKey | AKLURCDZNRIMSV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |