C14H18F3NO2 — CID 115518116
methyl 2-[2-[(4,4,4-trifluorobutylamino)methyl]phenyl]acetate (PubChem CID 115518116) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is methyl 2-[2-[(4,4,4-trifluorobutylamino)methyl]phenyl]acetate.
| Compound Name | methyl 2-[2-[(4,4,4-trifluorobutylamino)methyl]phenyl]acetate |
|---|---|
| PubChem CID | 115518116 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl 2-[2-[(4,4,4-trifluorobutylamino)methyl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccccc1CNCCCC(F)(F)F |
| InChI | InChI=1S/C14H18F3NO2/c1-20-13(19)9-11-5-2-3-6-12(11)10-18-8-4-7-14(15,16)17/h2-3,5-6,18H,4,7-10H2,1H3 |
| InChIKey | GMOPIULJYIECKQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|