C14H21ClFN — CID 106117128
2-(2-chloroethyl)-N-[(2-fluorophenyl)methyl]pentan-1-amine (PubChem CID 106117128) has the molecular formula C14H21ClFN and a molecular weight of 257.78 g/mol. Its IUPAC name is 2-(2-chloroethyl)-N-[(2-fluorophenyl)methyl]pentan-1-amine.
| Compound Name | 2-(2-chloroethyl)-N-[(2-fluorophenyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 106117128 |
| Molecular Formula | C14H21ClFN |
| Molecular Weight | 257.78 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-(2-chloroethyl)-N-[(2-fluorophenyl)methyl]pentan-1-amine |
| SMILES | CCCC(CCCl)CNCc1ccccc1F |
| InChI | InChI=1S/C14H21ClFN/c1-2-5-12(8-9-15)10-17-11-13-6-3-4-7-14(13)16/h3-4,6-7,12,17H,2,5,8-11H2,1H3 |
| InChIKey | FJQNPQPCMKSMSG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.78 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|