C9H18ClF2N — CID 106117170
2-(2-chloroethyl)-N-(2,2-difluoroethyl)pentan-1-amine (PubChem CID 106117170) has the molecular formula C9H18ClF2N and a molecular weight of 213.70 g/mol. Its IUPAC name is 2-(2-chloroethyl)-N-(2,2-difluoroethyl)pentan-1-amine.
| Compound Name | 2-(2-chloroethyl)-N-(2,2-difluoroethyl)pentan-1-amine |
|---|---|
| PubChem CID | 106117170 |
| Molecular Formula | C9H18ClF2N |
| Molecular Weight | 213.70 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 2-(2-chloroethyl)-N-(2,2-difluoroethyl)pentan-1-amine |
| SMILES | CCCC(CCCl)CNCC(F)F |
| InChI | InChI=1S/C9H18ClF2N/c1-2-3-8(4-5-10)6-13-7-9(11)12/h8-9,13H,2-7H2,1H3 |
| InChIKey | IBSNAKYOVOACQP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.70 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|