C14H20ClF2N — CID 114145599
2-(2-chloroethyl)-N-[(2,5-difluorophenyl)methyl]pentan-1-amine (PubChem CID 114145599) has the molecular formula C14H20ClF2N and a molecular weight of 275.77 g/mol. Its IUPAC name is 2-(2-chloroethyl)-N-[(2,5-difluorophenyl)methyl]pentan-1-amine.
| Compound Name | 2-(2-chloroethyl)-N-[(2,5-difluorophenyl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 114145599 |
| Molecular Formula | C14H20ClF2N |
| Molecular Weight | 275.77 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-(2-chloroethyl)-N-[(2,5-difluorophenyl)methyl]pentan-1-amine |
| SMILES | CCCC(CCCl)CNCc1cc(F)ccc1F |
| InChI | InChI=1S/C14H20ClF2N/c1-2-3-11(6-7-15)9-18-10-12-8-13(16)4-5-14(12)17/h4-5,8,11,18H,2-3,6-7,9-10H2,1H3 |
| InChIKey | AHNIRBXMAVFOEC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.77 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|