C13H16ClF2N — CID 114757613
N-[[1-(2-chloroethyl)cyclopropyl]methyl]-1-(2,5-difluorophenyl)methanamine (PubChem CID 114757613) has the molecular formula C13H16ClF2N and a molecular weight of 259.73 g/mol. Its IUPAC name is N-[[1-(2-chloroethyl)cyclopropyl]methyl]-1-(2,5-difluorophenyl)methanamine.
| Compound Name | N-[[1-(2-chloroethyl)cyclopropyl]methyl]-1-(2,5-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 114757613 |
| Molecular Formula | C13H16ClF2N |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | N-[[1-(2-chloroethyl)cyclopropyl]methyl]-1-(2,5-difluorophenyl)methanamine |
| SMILES | Fc1ccc(F)c(CNCC2(CCCl)CC2)c1 |
| InChI | InChI=1S/C13H16ClF2N/c14-6-5-13(3-4-13)9-17-8-10-7-11(15)1-2-12(10)16/h1-2,7,17H,3-6,8-9H2 |
| InChIKey | CGPGPZGUNDIOFM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|