C12H14BrClFN — CID 115455628
1-(2-bromo-4-fluorophenyl)-N-[[1-(chloromethyl)cyclopropyl]methyl]methanamine (PubChem CID 115455628) has the molecular formula C12H14BrClFN and a molecular weight of 306.61 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-N-[[1-(chloromethyl)cyclopropyl]methyl]methanamine.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-N-[[1-(chloromethyl)cyclopropyl]methyl]methanamine |
|---|---|
| PubChem CID | 115455628 |
| Molecular Formula | C12H14BrClFN |
| Molecular Weight | 306.61 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-N-[[1-(chloromethyl)cyclopropyl]methyl]methanamine |
| SMILES | Fc1ccc(CNCC2(CCl)CC2)c(Br)c1 |
| InChI | InChI=1S/C12H14BrClFN/c13-11-5-10(15)2-1-9(11)6-16-8-12(7-14)3-4-12/h1-2,5,16H,3-4,6-8H2 |
| InChIKey | ZZTUWZIEOJKHAN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.61 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|