C14H24ClNS — CID 106117199
2-(2-chloroethyl)-N-[(5-ethylthiophen-2-yl)methyl]pentan-1-amine (PubChem CID 106117199) has the molecular formula C14H24ClNS and a molecular weight of 273.87 g/mol. Its IUPAC name is 2-(2-chloroethyl)-N-[(5-ethylthiophen-2-yl)methyl]pentan-1-amine.
| Compound Name | 2-(2-chloroethyl)-N-[(5-ethylthiophen-2-yl)methyl]pentan-1-amine |
|---|---|
| PubChem CID | 106117199 |
| Molecular Formula | C14H24ClNS |
| Molecular Weight | 273.87 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-(2-chloroethyl)-N-[(5-ethylthiophen-2-yl)methyl]pentan-1-amine |
| SMILES | CCCC(CCCl)CNCc1ccc(CC)s1 |
| InChI | InChI=1S/C14H24ClNS/c1-3-5-12(8-9-15)10-16-11-14-7-6-13(4-2)17-14/h6-7,12,16H,3-5,8-11H2,1-2H3 |
| InChIKey | UYZZFXZJPARMPI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.87 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|