C10H12F3NO2 — CID 103948931
2-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]-6-fluorophenol (PubChem CID 103948931) has the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. Its IUPAC name is 2-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]-6-fluorophenol.
| Compound Name | 2-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]-6-fluorophenol |
|---|---|
| PubChem CID | 103948931 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]-6-fluorophenol |
| SMILES | Oc1c(F)cccc1CNCC(O)C(F)F |
| InChI | InChI=1S/C10H12F3NO2/c11-7-3-1-2-6(9(7)16)4-14-5-8(15)10(12)13/h1-3,8,10,14-16H,4-5H2 |
| InChIKey | WIFSCZQEFYTWLG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|