C10H12ClF2NO2 — CID 103731573
3-chloro-2-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]phenol (PubChem CID 103731573) has the molecular formula C10H12ClF2NO2 and a molecular weight of 251.66 g/mol. Its IUPAC name is 3-chloro-2-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]phenol.
| Compound Name | 3-chloro-2-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 103731573 |
| Molecular Formula | C10H12ClF2NO2 |
| Molecular Weight | 251.66 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 3-chloro-2-[[(3,3-difluoro-2-hydroxypropyl)amino]methyl]phenol |
| SMILES | Oc1cccc(Cl)c1CNCC(O)C(F)F |
| InChI | InChI=1S/C10H12ClF2NO2/c11-7-2-1-3-8(15)6(7)4-14-5-9(16)10(12)13/h1-3,9-10,14-16H,4-5H2 |
| InChIKey | MOVLKOXUVAOMEB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.66 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|