C15H19ClN2OS — CID 78959189
3-chloro-2-[[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]methyl]phenol (PubChem CID 78959189) has the molecular formula C15H19ClN2OS and a molecular weight of 310.85 g/mol. Its IUPAC name is 3-chloro-2-[[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]methyl]phenol.
| Compound Name | 3-chloro-2-[[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 78959189 |
| Molecular Formula | C15H19ClN2OS |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 3-chloro-2-[[[2-(dimethylamino)-2-thiophen-2-ylethyl]amino]methyl]phenol |
| SMILES | CN(C)C(CNCc1c(O)cccc1Cl)c1cccs1 |
| InChI | InChI=1S/C15H19ClN2OS/c1-18(2)13(15-7-4-8-20-15)10-17-9-11-12(16)5-3-6-14(11)19/h3-8,13,17,19H,9-10H2,1-2H3 |
| InChIKey | DMZFWSMUIWEEGH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|