C17H23F3N2O — CID 119341574
1-amino-N-[3-[3-(trifluoromethyl)phenyl]butyl]cyclopentane-1-carboxamide (PubChem CID 119341574) has the molecular formula C17H23F3N2O and a molecular weight of 328.38 g/mol. Its IUPAC name is 1-amino-N-[3-[3-(trifluoromethyl)phenyl]butyl]cyclopentane-1-carboxamide.
| Compound Name | 1-amino-N-[3-[3-(trifluoromethyl)phenyl]butyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 119341574 |
| Molecular Formula | C17H23F3N2O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-amino-N-[3-[3-(trifluoromethyl)phenyl]butyl]cyclopentane-1-carboxamide |
| SMILES | CC(CCNC(=O)C1(N)CCCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H23F3N2O/c1-12(13-5-4-6-14(11-13)17(18,19)20)7-10-22-15(23)16(21)8-2-3-9-16/h4-6,11-12H,2-3,7-10,21H2,1H3,(H,22,23) |
| InChIKey | KCCCQIVKYLDNQX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |