C17H21F3N2O3 — CID 122004719
1-[3-[3-(trifluoromethyl)phenyl]butylcarbamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 122004719) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 1-[3-[3-(trifluoromethyl)phenyl]butylcarbamoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[3-[3-(trifluoromethyl)phenyl]butylcarbamoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122004719 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[3-[3-(trifluoromethyl)phenyl]butylcarbamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC(CCNC(=O)N1CCC(C(=O)O)C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H21F3N2O3/c1-11(12-3-2-4-14(9-12)17(18,19)20)5-7-21-16(25)22-8-6-13(10-22)15(23)24/h2-4,9,11,13H,5-8,10H2,1H3,(H,21,25)(H,23,24) |
| InChIKey | XMLYQRXRMDKVRW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |