C18H23F3N2O3 — CID 122000122
1-[[2-methyl-1-[3-(trifluoromethyl)phenyl]propyl]carbamoyl]piperidine-3-carboxylic acid (PubChem CID 122000122) has the molecular formula C18H23F3N2O3 and a molecular weight of 372.39 g/mol. Its IUPAC name is 1-[[2-methyl-1-[3-(trifluoromethyl)phenyl]propyl]carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[[2-methyl-1-[3-(trifluoromethyl)phenyl]propyl]carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122000122 |
| Molecular Formula | C18H23F3N2O3 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-[[2-methyl-1-[3-(trifluoromethyl)phenyl]propyl]carbamoyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)C(NC(=O)N1CCCC(C(=O)O)C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H23F3N2O3/c1-11(2)15(12-5-3-7-14(9-12)18(19,20)21)22-17(26)23-8-4-6-13(10-23)16(24)25/h3,5,7,9,11,13,15H,4,6,8,10H2,1-2H3,(H,22,26)(H,24,25) |
| InChIKey | APWGYHVWQHASHJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |