C21H22F3NO3 — CID 3638795
1-[(3-methoxyphenyl)-[3-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylic acid (PubChem CID 3638795) has the molecular formula C21H22F3NO3 and a molecular weight of 393.41 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)-[3-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(3-methoxyphenyl)-[3-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3638795 |
| Molecular Formula | C21H22F3NO3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-[(3-methoxyphenyl)-[3-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylic acid |
| SMILES | COc1cccc(C(c2cccc(C(F)(F)F)c2)N2CCCC(C(=O)O)C2)c1 |
| InChI | InChI=1S/C21H22F3NO3/c1-28-18-9-3-6-15(12-18)19(25-10-4-7-16(13-25)20(26)27)14-5-2-8-17(11-14)21(22,23)24/h2-3,5-6,8-9,11-12,16,19H,4,7,10,13H2,1H3,(H,26,27) |
| InChIKey | ZJLQEKZKWXINNW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |