C24H22F3NO2 — CID 4288267
1-[naphthalen-1-yl-[3-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylic acid (PubChem CID 4288267) has the molecular formula C24H22F3NO2 and a molecular weight of 413.44 g/mol. Its IUPAC name is 1-[naphthalen-1-yl-[3-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[naphthalen-1-yl-[3-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 4288267 |
| Molecular Formula | C24H22F3NO2 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 1-[naphthalen-1-yl-[3-(trifluoromethyl)phenyl]methyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(c2cccc(C(F)(F)F)c2)c2cccc3ccccc23)C1 |
| InChI | InChI=1S/C24H22F3NO2/c25-24(26,27)19-10-3-8-17(14-19)22(28-13-5-9-18(15-28)23(29)30)21-12-4-7-16-6-1-2-11-20(16)21/h1-4,6-8,10-12,14,18,22H,5,9,13,15H2,(H,29,30) |
| InChIKey | OJAIIWWANSJOMY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |