C17H23F3N2O3 — CID 122004723
2-methyl-3-[methyl-[3-[3-(trifluoromethyl)phenyl]butylcarbamoyl]amino]propanoic acid (PubChem CID 122004723) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[3-[3-(trifluoromethyl)phenyl]butylcarbamoyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-[3-[3-(trifluoromethyl)phenyl]butylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122004723 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-methyl-3-[methyl-[3-[3-(trifluoromethyl)phenyl]butylcarbamoyl]amino]propanoic acid |
| SMILES | CC(CN(C)C(=O)NCCC(C)c1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C17H23F3N2O3/c1-11(13-5-4-6-14(9-13)17(18,19)20)7-8-21-16(25)22(3)10-12(2)15(23)24/h4-6,9,11-12H,7-8,10H2,1-3H3,(H,21,25)(H,23,24) |
| InChIKey | MKBURTURZCLRFL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |