C18H30O3S — CID 58052796
6-(4-tert-butylphenyl)-5,5-dimethylhexane-1-sulfonic acid (PubChem CID 58052796) has the molecular formula C18H30O3S and a molecular weight of 326.50 g/mol. Its IUPAC name is 6-(4-tert-butylphenyl)-5,5-dimethylhexane-1-sulfonic acid.
| Compound Name | 6-(4-tert-butylphenyl)-5,5-dimethylhexane-1-sulfonic acid |
|---|---|
| PubChem CID | 58052796 |
| Molecular Formula | C18H30O3S |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 6-(4-tert-butylphenyl)-5,5-dimethylhexane-1-sulfonic acid |
| SMILES | CC(C)(CCCCS(=O)(=O)O)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H30O3S/c1-17(2,3)16-10-8-15(9-11-16)14-18(4,5)12-6-7-13-22(19,20)21/h8-11H,6-7,12-14H2,1-5H3,(H,19,20,21) |
| InChIKey | KQRNXMMMYRMZTP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|