C16H21F3O2 — CID 91192334
6,6-dimethyl-7-[4-(trifluoromethyl)phenyl]heptanoic acid (PubChem CID 91192334) has the molecular formula C16H21F3O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 6,6-dimethyl-7-[4-(trifluoromethyl)phenyl]heptanoic acid.
| Compound Name | 6,6-dimethyl-7-[4-(trifluoromethyl)phenyl]heptanoic acid |
|---|---|
| PubChem CID | 91192334 |
| Molecular Formula | C16H21F3O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 6,6-dimethyl-7-[4-(trifluoromethyl)phenyl]heptanoic acid |
| SMILES | CC(C)(CCCCC(=O)O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3O2/c1-15(2,10-4-3-5-14(20)21)11-12-6-8-13(9-7-12)16(17,18)19/h6-9H,3-5,10-11H2,1-2H3,(H,20,21) |
| InChIKey | MKRWSROKXNIWQA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|