C17H24F2O2 — CID 66258604
6,6-difluoro-6-[4-(2-methylbutan-2-yl)phenyl]hexanoic acid (PubChem CID 66258604) has the molecular formula C17H24F2O2 and a molecular weight of 298.37 g/mol. Its IUPAC name is 6,6-difluoro-6-[4-(2-methylbutan-2-yl)phenyl]hexanoic acid.
| Compound Name | 6,6-difluoro-6-[4-(2-methylbutan-2-yl)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 66258604 |
| Molecular Formula | C17H24F2O2 |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 6,6-difluoro-6-[4-(2-methylbutan-2-yl)phenyl]hexanoic acid |
| SMILES | CCC(C)(C)c1ccc(C(F)(F)CCCCC(=O)O)cc1 |
| InChI | InChI=1S/C17H24F2O2/c1-4-16(2,3)13-8-10-14(11-9-13)17(18,19)12-6-5-7-15(20)21/h8-11H,4-7,12H2,1-3H3,(H,20,21) |
| InChIKey | ZGESAHPULSSUIG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|