C17H22F2O2 — CID 28931302
5-(4-cyclohexylphenyl)-5,5-difluoropentanoic acid (PubChem CID 28931302) has the molecular formula C17H22F2O2 and a molecular weight of 296.36 g/mol. Its IUPAC name is 5-(4-cyclohexylphenyl)-5,5-difluoropentanoic acid.
| Compound Name | 5-(4-cyclohexylphenyl)-5,5-difluoropentanoic acid |
|---|---|
| PubChem CID | 28931302 |
| Molecular Formula | C17H22F2O2 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 5-(4-cyclohexylphenyl)-5,5-difluoropentanoic acid |
| SMILES | O=C(O)CCCC(F)(F)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C17H22F2O2/c18-17(19,12-4-7-16(20)21)15-10-8-14(9-11-15)13-5-2-1-3-6-13/h8-11,13H,1-7,12H2,(H,20,21) |
| InChIKey | ZEHQYDOJCLPNBY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |