3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid

C16H20F2O2 — CID 162547919

IUPAC3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid
SMILESCC1CCC(c2ccc(C(F)(F)CC(=O)O)cc2)CC1
InChIInChI=1S/C16H20F2O2/c1-11-2-4-12(5-3-11)13-6-8-14(9-7-13)16(17,18)10-15(19)20/h6-9,11-12H,2-5,10H2,1H3,(H,19,20)
InChIKeySKAFEZITWJTWDZ-UHFFFAOYSA-N
MW282.33 g/mol
LogP4.55
Rot. Bonds4

About 3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid

3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid (PubChem CID 162547919) has the molecular formula C16H20F2O2 and a molecular weight of 282.33 g/mol. Its IUPAC name is 3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid.

Molecular Properties

Compound Name3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid
PubChem CID162547919
Molecular FormulaC16H20F2O2
Molecular Weight282.33 g/mol
Exact Mass282.14
IUPAC Name3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid
SMILESCC1CCC(c2ccc(C(F)(F)CC(=O)O)cc2)CC1
InChIInChI=1S/C16H20F2O2/c1-11-2-4-12(5-3-11)13-6-8-14(9-7-13)16(17,18)10-15(19)20/h6-9,11-12H,2-5,10H2,1H3,(H,19,20)
InChIKeySKAFEZITWJTWDZ-UHFFFAOYSA-N
XLogP4.55
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.33
LogP ≤ 54.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid?
The IUPAC name of 3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid (CID 162547919) is 3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid.
What is the SMILES notation for 3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid?
The canonical SMILES for 3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid is CC1CCC(c2ccc(C(F)(F)CC(=O)O)cc2)CC1.
What is the InChIKey of 3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid?
The InChIKey is SKAFEZITWJTWDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F2O2/c1-11-2-4-12(5-3-11)13-6-8-14(9-7-13)16(17,18)10-15(19)20/h6-9,11-12H,2-5,10H2,1H3,(H,19,20).
What are the key properties of 3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid?
3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid has a molecular weight of 282.33 g/mol, XLogP of 4.55, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid is sourced from PubChem (CID 162547919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).