C16H20F2O2 — CID 162547919
3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid (PubChem CID 162547919) has the molecular formula C16H20F2O2 and a molecular weight of 282.33 g/mol. Its IUPAC name is 3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid.
| Compound Name | 3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 162547919 |
| Molecular Formula | C16H20F2O2 |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3,3-difluoro-3-[4-(4-methylcyclohexyl)phenyl]propanoic acid |
| SMILES | CC1CCC(c2ccc(C(F)(F)CC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C16H20F2O2/c1-11-2-4-12(5-3-11)13-6-8-14(9-7-13)16(17,18)10-15(19)20/h6-9,11-12H,2-5,10H2,1H3,(H,19,20) |
| InChIKey | SKAFEZITWJTWDZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |