C29H31F15O — CID 18650515
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-[4-[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]phenyl]octan-1-one (PubChem CID 18650515) has the molecular formula C29H31F15O and a molecular weight of 680.54 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-[4-[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]phenyl]octan-1-one.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-[4-[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]phenyl]octan-1-one |
|---|---|
| PubChem CID | 18650515 |
| Molecular Formula | C29H31F15O |
| Molecular Weight | 680.54 g/mol |
| Exact Mass | 680.21 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-[4-[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]phenyl]octan-1-one |
| SMILES | CC1CCC(CCC2CCC(c3ccc(C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C29H31F15O/c1-16-2-4-17(5-3-16)6-7-18-8-10-19(11-9-18)20-12-14-21(15-13-20)22(45)23(30,31)24(32,33)25(34,35)26(36,37)27(38,39)28(40,41)29(42,43)44/h12-19H,2-11H2,1H3 |
| InChIKey | DYSUORKOHFOXNF-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.54 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|