About carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene
carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene (PubChem CID 90949618) has the molecular formula C22H32F2O
and a molecular weight of 350.49 g/mol. Its IUPAC name is carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene.
Molecular Properties
| Compound Name | carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene |
| PubChem CID | 90949618 |
| Molecular Formula | C22H32F2O |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene |
| SMILES | CC1CCC(CCC2CCC(c3ccccc3)CC2)CC1.O=C(F)F |
| InChI | InChI=1S/C21H32.CF2O/c1-17-7-9-18(10-8-17)11-12-19-13-15-21(16-14-19)20-5-3-2-4-6-20;2-1(3)4/h2-6,17-19,21H,7-16H2,1H3; |
| InChIKey | FFJDOTYTIMBSJX-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene?
The IUPAC name of carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene (CID 90949618) is carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene.
What is the SMILES notation for carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene?
The canonical SMILES for carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene is CC1CCC(CCC2CCC(c3ccccc3)CC2)CC1.O=C(F)F.
What is the InChIKey of carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene?
The InChIKey is FFJDOTYTIMBSJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32.CF2O/c1-17-7-9-18(10-8-17)11-12-19-13-15-21(16-14-19)20-5-3-2-4-6-20;2-1(3)4/h2-6,17-19,21H,7-16H2,1H3;.
What are the key properties of carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene?
carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene has a molecular weight of 350.49 g/mol, XLogP of 7.61, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbonyl difluoride;[4-[2-(4-methylcyclohexyl)ethyl]cyclohexyl]benzene is sourced from PubChem (CID 90949618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).