C13H14F2O2 — CID 118647046
ethyl 2-(4-cyclopropylphenyl)-2,2-difluoroacetate (PubChem CID 118647046) has the molecular formula C13H14F2O2 and a molecular weight of 240.25 g/mol. Its IUPAC name is ethyl 2-(4-cyclopropylphenyl)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(4-cyclopropylphenyl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 118647046 |
| Molecular Formula | C13H14F2O2 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | ethyl 2-(4-cyclopropylphenyl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C13H14F2O2/c1-2-17-12(16)13(14,15)11-7-5-10(6-8-11)9-3-4-9/h5-9H,2-4H2,1H3 |
| InChIKey | PEOKNRUXUWTPBF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |