C15H19F2NO2 — CID 162397983
ethyl 2-[4-(tert-butyliminomethyl)phenyl]-2,2-difluoroacetate (PubChem CID 162397983) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is ethyl 2-[4-(tert-butyliminomethyl)phenyl]-2,2-difluoroacetate.
| Compound Name | ethyl 2-[4-(tert-butyliminomethyl)phenyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 162397983 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | ethyl 2-[4-(tert-butyliminomethyl)phenyl]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1ccc(/C=N/C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H19F2NO2/c1-5-20-13(19)15(16,17)12-8-6-11(7-9-12)10-18-14(2,3)4/h6-10H,5H2,1-4H3/b18-10+ |
| InChIKey | TYOIICQAMVZBFN-VCHYOVAHSA-N |
| XLogP | 3.56 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|