C12H14F2O3 — CID 62395381
ethyl 2-(4-ethoxyphenyl)-2,2-difluoroacetate (PubChem CID 62395381) has the molecular formula C12H14F2O3 and a molecular weight of 244.24 g/mol. Its IUPAC name is ethyl 2-(4-ethoxyphenyl)-2,2-difluoroacetate.
| Compound Name | ethyl 2-(4-ethoxyphenyl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 62395381 |
| Molecular Formula | C12H14F2O3 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | ethyl 2-(4-ethoxyphenyl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C12H14F2O3/c1-3-16-10-7-5-9(6-8-10)12(13,14)11(15)17-4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | GAEQNBWOUNINSN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |