C15H18F2O4 — CID 162398541
tert-butyl 4-(2-ethoxy-1,1-difluoro-2-oxoethyl)benzoate (PubChem CID 162398541) has the molecular formula C15H18F2O4 and a molecular weight of 300.30 g/mol. Its IUPAC name is tert-butyl 4-(2-ethoxy-1,1-difluoro-2-oxoethyl)benzoate.
| Compound Name | tert-butyl 4-(2-ethoxy-1,1-difluoro-2-oxoethyl)benzoate |
|---|---|
| PubChem CID | 162398541 |
| Molecular Formula | C15H18F2O4 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | tert-butyl 4-(2-ethoxy-1,1-difluoro-2-oxoethyl)benzoate |
| SMILES | CCOC(=O)C(F)(F)c1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H18F2O4/c1-5-20-13(19)15(16,17)11-8-6-10(7-9-11)12(18)21-14(2,3)4/h6-9H,5H2,1-4H3 |
| InChIKey | SBIMPGKTVXXUGL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |