C15H21NO4 — CID 134581727
4-O-tert-butyl 1-O-(ethylaminomethyl) benzene-1,4-dicarboxylate (PubChem CID 134581727) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-(ethylaminomethyl) benzene-1,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 1-O-(ethylaminomethyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134581727 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 4-O-tert-butyl 1-O-(ethylaminomethyl) benzene-1,4-dicarboxylate |
| SMILES | CCNCOC(=O)c1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H21NO4/c1-5-16-10-19-13(17)11-6-8-12(9-7-11)14(18)20-15(2,3)4/h6-9,16H,5,10H2,1-4H3 |
| InChIKey | QYVCFIXLXNUNLL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|