C16H22F3NO4S — CID 22246978
7-[methylsulfonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]heptanoic acid (PubChem CID 22246978) has the molecular formula C16H22F3NO4S and a molecular weight of 381.42 g/mol. Its IUPAC name is 7-[methylsulfonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]heptanoic acid.
| Compound Name | 7-[methylsulfonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 22246978 |
| Molecular Formula | C16H22F3NO4S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 7-[methylsulfonyl-[[4-(trifluoromethyl)phenyl]methyl]amino]heptanoic acid |
| SMILES | CS(=O)(=O)N(CCCCCCC(=O)O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H22F3NO4S/c1-25(23,24)20(11-5-3-2-4-6-15(21)22)12-13-7-9-14(10-8-13)16(17,18)19/h7-10H,2-6,11-12H2,1H3,(H,21,22) |
| InChIKey | DGLIOICYUGZBLE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|