C25H35NO4S — CID 54147844
ethyl 7-[methylsulfonyl-[[4-(2-phenylethyl)phenyl]methyl]amino]heptanoate (PubChem CID 54147844) has the molecular formula C25H35NO4S and a molecular weight of 445.63 g/mol. Its IUPAC name is ethyl 7-[methylsulfonyl-[[4-(2-phenylethyl)phenyl]methyl]amino]heptanoate.
| Compound Name | ethyl 7-[methylsulfonyl-[[4-(2-phenylethyl)phenyl]methyl]amino]heptanoate |
|---|---|
| PubChem CID | 54147844 |
| Molecular Formula | C25H35NO4S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | ethyl 7-[methylsulfonyl-[[4-(2-phenylethyl)phenyl]methyl]amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCN(Cc1ccc(CCc2ccccc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C25H35NO4S/c1-3-30-25(27)13-9-4-5-10-20-26(31(2,28)29)21-24-18-16-23(17-19-24)15-14-22-11-7-6-8-12-22/h6-8,11-12,16-19H,3-5,9-10,13-15,20-21H2,1-2H3 |
| InChIKey | OFQFZRZVMULWOF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|