C17H26O3 — CID 68632633
methyl 7-(4-methoxyphenyl)-6,6-dimethylheptanoate (PubChem CID 68632633) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is methyl 7-(4-methoxyphenyl)-6,6-dimethylheptanoate.
| Compound Name | methyl 7-(4-methoxyphenyl)-6,6-dimethylheptanoate |
|---|---|
| PubChem CID | 68632633 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | methyl 7-(4-methoxyphenyl)-6,6-dimethylheptanoate |
| SMILES | COC(=O)CCCCC(C)(C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H26O3/c1-17(2,12-6-5-7-16(18)20-4)13-14-8-10-15(19-3)11-9-14/h8-11H,5-7,12-13H2,1-4H3 |
| InChIKey | DWHMTNYVXWTAOP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|