C27H34O8 — CID 15840218
9-O-[3,5-dimethoxy-2-[2-(4-methoxyphenyl)acetyl]phenyl] 1-O-methyl nonanedioate (PubChem CID 15840218) has the molecular formula C27H34O8 and a molecular weight of 486.56 g/mol. Its IUPAC name is 9-O-[3,5-dimethoxy-2-[2-(4-methoxyphenyl)acetyl]phenyl] 1-O-methyl nonanedioate.
| Compound Name | 9-O-[3,5-dimethoxy-2-[2-(4-methoxyphenyl)acetyl]phenyl] 1-O-methyl nonanedioate |
|---|---|
| PubChem CID | 15840218 |
| Molecular Formula | C27H34O8 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 9-O-[3,5-dimethoxy-2-[2-(4-methoxyphenyl)acetyl]phenyl] 1-O-methyl nonanedioate |
| SMILES | COC(=O)CCCCCCCC(=O)Oc1cc(OC)cc(OC)c1C(=O)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H34O8/c1-31-20-14-12-19(13-15-20)16-22(28)27-23(33-3)17-21(32-2)18-24(27)35-26(30)11-9-7-5-6-8-10-25(29)34-4/h12-15,17-18H,5-11,16H2,1-4H3 |
| InChIKey | DIRCKQVLIRTFGM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|