C12H15F3 — CID 14921472
1-(2,2-dimethylpropyl)-4-(trifluoromethyl)benzene (PubChem CID 14921472) has the molecular formula C12H15F3 and a molecular weight of 216.25 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(2,2-dimethylpropyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 14921472 |
| Molecular Formula | C12H15F3 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-4-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3/c1-11(2,3)8-9-4-6-10(7-5-9)12(13,14)15/h4-7H,8H2,1-3H3 |
| InChIKey | FTCSXJFZRHVXFY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |