C15H21F3 — CID 146324258
1-(2,2-dimethylhexyl)-4-(trifluoromethyl)benzene (PubChem CID 146324258) has the molecular formula C15H21F3 and a molecular weight of 258.33 g/mol. Its IUPAC name is 1-(2,2-dimethylhexyl)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(2,2-dimethylhexyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 146324258 |
| Molecular Formula | C15H21F3 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1-(2,2-dimethylhexyl)-4-(trifluoromethyl)benzene |
| SMILES | CCCCC(C)(C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H21F3/c1-4-5-10-14(2,3)11-12-6-8-13(9-7-12)15(16,17)18/h6-9H,4-5,10-11H2,1-3H3 |
| InChIKey | AVJHQRRHAOECRH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |