About 1-ethyl-4-(trifluoromethyl)benzene;hexane
1-ethyl-4-(trifluoromethyl)benzene;hexane (PubChem CID 143348513) has the molecular formula C15H23F3
and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-ethyl-4-(trifluoromethyl)benzene;hexane.
Molecular Properties
| Compound Name | 1-ethyl-4-(trifluoromethyl)benzene;hexane |
| PubChem CID | 143348513 |
| Molecular Formula | C15H23F3 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 1-ethyl-4-(trifluoromethyl)benzene;hexane |
| SMILES | CCCCCC.CCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H9F3.C6H14/c1-2-7-3-5-8(6-4-7)9(10,11)12;1-3-5-6-4-2/h3-6H,2H2,1H3;3-6H2,1-2H3 |
| InChIKey | WNQFGIJGXJQWAH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-(trifluoromethyl)benzene;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-(trifluoromethyl)benzene;hexane?
The IUPAC name of 1-ethyl-4-(trifluoromethyl)benzene;hexane (CID 143348513) is 1-ethyl-4-(trifluoromethyl)benzene;hexane.
What is the SMILES notation for 1-ethyl-4-(trifluoromethyl)benzene;hexane?
The canonical SMILES for 1-ethyl-4-(trifluoromethyl)benzene;hexane is CCCCCC.CCc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 1-ethyl-4-(trifluoromethyl)benzene;hexane?
The InChIKey is WNQFGIJGXJQWAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3.C6H14/c1-2-7-3-5-8(6-4-7)9(10,11)12;1-3-5-6-4-2/h3-6H,2H2,1H3;3-6H2,1-2H3.
What are the key properties of 1-ethyl-4-(trifluoromethyl)benzene;hexane?
1-ethyl-4-(trifluoromethyl)benzene;hexane has a molecular weight of 260.34 g/mol, XLogP of 5.85, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-(trifluoromethyl)benzene;hexane is sourced from PubChem (CID 143348513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).