C38H55F3 — CID 143010329
2,4-dimethyl-1-pentylbenzene;1-ethyl-4-pentylbenzene;1-pentyl-4-(trifluoromethyl)benzene (PubChem CID 143010329) has the molecular formula C38H55F3 and a molecular weight of 568.85 g/mol. Its IUPAC name is 2,4-dimethyl-1-pentylbenzene;1-ethyl-4-pentylbenzene;1-pentyl-4-(trifluoromethyl)benzene.
| Compound Name | 2,4-dimethyl-1-pentylbenzene;1-ethyl-4-pentylbenzene;1-pentyl-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 143010329 |
| Molecular Formula | C38H55F3 |
| Molecular Weight | 568.85 g/mol |
| Exact Mass | 568.43 |
| IUPAC Name | 2,4-dimethyl-1-pentylbenzene;1-ethyl-4-pentylbenzene;1-pentyl-4-(trifluoromethyl)benzene |
| SMILES | CCCCCc1ccc(C(F)(F)F)cc1.CCCCCc1ccc(C)cc1C.CCCCCc1ccc(CC)cc1 |
| InChI | InChI=1S/2C13H20.C12H15F3/c1-4-5-6-7-13-9-8-11(2)10-12(13)3;1-3-5-6-7-13-10-8-12(4-2)9-11-13;1-2-3-4-5-10-6-8-11(9-7-10)12(13,14)15/h8-10H,4-7H2,1-3H3;8-11H,3-7H2,1-2H3;6-9H,2-5H2,1H3 |
| InChIKey | WGDVYKZCNKCPCX-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.85 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|